C16H14ClNO3 — CID 17341111
(E)-3-(5-chloro-2-methoxyphenyl)-N-(3-hydroxyphenyl)prop-2-enamide (PubChem CID 17341111) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is (E)-3-(5-chloro-2-methoxyphenyl)-N-(3-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-2-methoxyphenyl)-N-(3-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17341111 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (E)-3-(5-chloro-2-methoxyphenyl)-N-(3-hydroxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1/C=C/C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C16H14ClNO3/c1-21-15-7-6-12(17)9-11(15)5-8-16(20)18-13-3-2-4-14(19)10-13/h2-10,19H,1H3,(H,18,20)/b8-5+ |
| InChIKey | AOPPJOSETHYRRF-VMPITWQZSA-N |
| XLogP | 3.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|