C8H8N4O5S — CID 173411436
methyl 2-[(Z)-[1-(5-formamido-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxyacetate (PubChem CID 173411436) has the molecular formula C8H8N4O5S and a molecular weight of 272.24 g/mol. Its IUPAC name is methyl 2-[(Z)-[1-(5-formamido-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxyacetate.
| Compound Name | methyl 2-[(Z)-[1-(5-formamido-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 173411436 |
| Molecular Formula | C8H8N4O5S |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | methyl 2-[(Z)-[1-(5-formamido-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxyacetate |
| SMILES | COC(=O)CO/N=C(\C=O)c1nsc(NC=O)n1 |
| InChI | InChI=1S/C8H8N4O5S/c1-16-6(15)3-17-11-5(2-13)7-10-8(9-4-14)18-12-7/h2,4H,3H2,1H3,(H,9,10,12,14)/b11-5+ |
| InChIKey | ZJWRYESKWBHHBS-VZUCSPMQSA-N |
| XLogP | -0.80 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|