About sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride
sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride (PubChem CID 173411474) has the molecular formula C3H8N5NaS
and a molecular weight of 169.19 g/mol. Its IUPAC name is sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride.
Molecular Properties
| Compound Name | sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride |
| PubChem CID | 173411474 |
| Molecular Formula | C3H8N5NaS |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride |
| SMILES | CCNn1[nH]nnc1=S.[H-].[Na+] |
| InChI | InChI=1S/C3H7N5S.Na.H/c1-2-4-8-3(9)5-6-7-8;;/h4H,2H2,1H3,(H,5,7,9);;/q;+1;-1 |
| InChIKey | KGNUXEINJYWBEL-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride?
The IUPAC name of sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride (CID 173411474) is sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride.
What is the SMILES notation for sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride?
The canonical SMILES for sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride is CCNn1[nH]nnc1=S.[H-].[Na+].
What is the InChIKey of sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride?
The InChIKey is KGNUXEINJYWBEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N5S.Na.H/c1-2-4-8-3(9)5-6-7-8;;/h4H,2H2,1H3,(H,5,7,9);;/q;+1;-1.
What are the key properties of sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride?
sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride has a molecular weight of 169.19 g/mol, XLogP of -2.98, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-(ethylamino)-2H-tetrazole-5-thione;hydride is sourced from PubChem (CID 173411474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).