C8H10Cl2F2 — CID 173412089
2-[(Z)-2,3-dichloro-3,3-difluoroprop-1-enyl]-1,1-dimethylcyclopropane (PubChem CID 173412089) has the molecular formula C8H10Cl2F2 and a molecular weight of 215.07 g/mol. Its IUPAC name is 2-[(Z)-2,3-dichloro-3,3-difluoroprop-1-enyl]-1,1-dimethylcyclopropane.
| Compound Name | 2-[(Z)-2,3-dichloro-3,3-difluoroprop-1-enyl]-1,1-dimethylcyclopropane |
|---|---|
| PubChem CID | 173412089 |
| Molecular Formula | C8H10Cl2F2 |
| Molecular Weight | 215.07 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 2-[(Z)-2,3-dichloro-3,3-difluoroprop-1-enyl]-1,1-dimethylcyclopropane |
| SMILES | CC1(C)CC1/C=C(\Cl)C(F)(F)Cl |
| InChI | InChI=1S/C8H10Cl2F2/c1-7(2)4-5(7)3-6(9)8(10,11)12/h3,5H,4H2,1-2H3/b6-3- |
| InChIKey | YYKZCSICDOXFRV-UTCJRWHESA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.07 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|