About 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol
5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol (PubChem CID 173412444) has the molecular formula C8H14NO2+
and a molecular weight of 156.20 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol |
| PubChem CID | 173412444 |
| Molecular Formula | C8H14NO2+ |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol |
| SMILES | CC1=C(O)C(C)[NH2+]C=C1CO |
| InChI | InChI=1S/C8H13NO2/c1-5-7(4-10)3-9-6(2)8(5)11/h3,6,9-11H,4H2,1-2H3/p+1 |
| InChIKey | RFHRZVRJMWVHNJ-UHFFFAOYSA-O |
| XLogP | -0.34 |
| TPSA | 57.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol?
The IUPAC name of 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol (CID 173412444) is 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol.
What is the SMILES notation for 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol?
The canonical SMILES for 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol is CC1=C(O)C(C)[NH2+]C=C1CO.
What is the InChIKey of 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol?
The InChIKey is RFHRZVRJMWVHNJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H13NO2/c1-5-7(4-10)3-9-6(2)8(5)11/h3,6,9-11H,4H2,1-2H3/p+1.
What are the key properties of 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol?
5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol has a molecular weight of 156.20 g/mol, XLogP of -0.34, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-2,4-dimethyl-1,2-dihydropyridin-1-ium-3-ol is sourced from PubChem (CID 173412444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).