C15H23N5O2S2 — CID 173412483
1-oxido-4-[3-[3-(piperidin-1-ylmethyl)thiophen-2-yl]oxypropylimino]-1,2,5-thiadiazol-1-ium-3-amine (PubChem CID 173412483) has the molecular formula C15H23N5O2S2 and a molecular weight of 369.52 g/mol. Its IUPAC name is 1-oxido-4-[3-[3-(piperidin-1-ylmethyl)thiophen-2-yl]oxypropylimino]-1,2,5-thiadiazol-1-ium-3-amine.
| Compound Name | 1-oxido-4-[3-[3-(piperidin-1-ylmethyl)thiophen-2-yl]oxypropylimino]-1,2,5-thiadiazol-1-ium-3-amine |
|---|---|
| PubChem CID | 173412483 |
| Molecular Formula | C15H23N5O2S2 |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-oxido-4-[3-[3-(piperidin-1-ylmethyl)thiophen-2-yl]oxypropylimino]-1,2,5-thiadiazol-1-ium-3-amine |
| SMILES | Nc1n[s+]([O-])[nH]/c1=N\CCCOc1sccc1CN1CCCCC1 |
| InChI | InChI=1S/C15H23N5O2S2/c16-13-14(19-24(21)18-13)17-6-4-9-22-15-12(5-10-23-15)11-20-7-2-1-3-8-20/h5,10H,1-4,6-9,11H2,(H2,16,18)(H,17,19) |
| InChIKey | KCROKXJRSJUDAU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|