C15H23N5OS3 — CID 173412565
1-oxido-4-[2-[[5-(piperidin-1-ylmethyl)thiophen-3-yl]methylsulfanyl]ethylimino]-1,2,5-thiadiazol-1-ium-3-amine (PubChem CID 173412565) has the molecular formula C15H23N5OS3 and a molecular weight of 385.58 g/mol. Its IUPAC name is 1-oxido-4-[2-[[5-(piperidin-1-ylmethyl)thiophen-3-yl]methylsulfanyl]ethylimino]-1,2,5-thiadiazol-1-ium-3-amine.
| Compound Name | 1-oxido-4-[2-[[5-(piperidin-1-ylmethyl)thiophen-3-yl]methylsulfanyl]ethylimino]-1,2,5-thiadiazol-1-ium-3-amine |
|---|---|
| PubChem CID | 173412565 |
| Molecular Formula | C15H23N5OS3 |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 1-oxido-4-[2-[[5-(piperidin-1-ylmethyl)thiophen-3-yl]methylsulfanyl]ethylimino]-1,2,5-thiadiazol-1-ium-3-amine |
| SMILES | Nc1n[s+]([O-])[nH]/c1=N\CCSCc1csc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C15H23N5OS3/c16-14-15(19-24(21)18-14)17-4-7-22-10-12-8-13(23-11-12)9-20-5-2-1-3-6-20/h8,11H,1-7,9-10H2,(H2,16,18)(H,17,19) |
| InChIKey | ARWHGIMAJQSHHF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|