About (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid
(3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid (PubChem CID 173412603) has the molecular formula C11H21NO3Si
and a molecular weight of 243.38 g/mol. Its IUPAC name is (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid |
| PubChem CID | 173412603 |
| Molecular Formula | C11H21NO3Si |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid |
| SMILES | C[SiH](C)OC(C(=O)O)[C@H](CC#N)C(C)(C)C |
| InChI | InChI=1S/C11H21NO3Si/c1-11(2,3)8(6-7-12)9(10(13)14)15-16(4)5/h8-9,16H,6H2,1-5H3,(H,13,14)/t8-,9?/m0/s1 |
| InChIKey | DMMGMFPYIOVZQA-IENPIDJESA-N |
| XLogP | 2.02 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid?
The IUPAC name of (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid (CID 173412603) is (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid.
What is the SMILES notation for (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid?
The canonical SMILES for (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid is C[SiH](C)OC(C(=O)O)[C@H](CC#N)C(C)(C)C.
What is the InChIKey of (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid?
The InChIKey is DMMGMFPYIOVZQA-IENPIDJESA-N. The full InChI is InChI=1S/C11H21NO3Si/c1-11(2,3)8(6-7-12)9(10(13)14)15-16(4)5/h8-9,16H,6H2,1-5H3,(H,13,14)/t8-,9?/m0/s1.
What are the key properties of (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid?
(3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid has a molecular weight of 243.38 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoic acid is sourced from PubChem (CID 173412603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).