About methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate
methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate (PubChem CID 173412974) has the molecular formula C12H23NO3Si
and a molecular weight of 257.41 g/mol. Its IUPAC name is methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate |
| PubChem CID | 173412974 |
| Molecular Formula | C12H23NO3Si |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate |
| SMILES | COC(=O)C(O[SiH](C)C)C(CC#N)C(C)(C)C |
| InChI | InChI=1S/C12H23NO3Si/c1-12(2,3)9(7-8-13)10(11(14)15-4)16-17(5)6/h9-10,17H,7H2,1-6H3 |
| InChIKey | XXSFNLZJFABHIF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate?
The IUPAC name of methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate (CID 173412974) is methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate.
What is the SMILES notation for methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate?
The canonical SMILES for methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate is COC(=O)C(O[SiH](C)C)C(CC#N)C(C)(C)C.
What is the InChIKey of methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate?
The InChIKey is XXSFNLZJFABHIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3Si/c1-12(2,3)9(7-8-13)10(11(14)15-4)16-17(5)6/h9-10,17H,7H2,1-6H3.
What are the key properties of methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate?
methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate has a molecular weight of 257.41 g/mol, XLogP of 2.10, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(cyanomethyl)-2-dimethylsilyloxy-4,4-dimethylpentanoate is sourced from PubChem (CID 173412974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).