About bis((5Z)-cycloocta-1,5-diene);dichlororhodium
bis((5Z)-cycloocta-1,5-diene);dichlororhodium (PubChem CID 173413305) has the molecular formula C16H24Cl2Rh
and a molecular weight of 390.18 g/mol. Its IUPAC name is bis((5Z)-cycloocta-1,5-diene);dichlororhodium.
Molecular Properties
| Compound Name | bis((5Z)-cycloocta-1,5-diene);dichlororhodium |
| PubChem CID | 173413305 |
| Molecular Formula | C16H24Cl2Rh |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | bis((5Z)-cycloocta-1,5-diene);dichlororhodium |
| SMILES | C1=CCC/C=C\CC1.C1=CCC/C=C\CC1.Cl[Rh]Cl |
| InChI | InChI=1S/2C8H12.2ClH.Rh/c2*1-2-4-6-8-7-5-3-1;;;/h2*1-2,7-8H,3-6H2;2*1H;/q;;;;+2/p-2/b2*2-1-,8-7?;;; |
| InChIKey | CNZJXEMAGREJBO-SXGRVCRXSA-L |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis((5Z)-cycloocta-1,5-diene);dichlororhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((5Z)-cycloocta-1,5-diene);dichlororhodium?
The IUPAC name of bis((5Z)-cycloocta-1,5-diene);dichlororhodium (CID 173413305) is bis((5Z)-cycloocta-1,5-diene);dichlororhodium.
What is the SMILES notation for bis((5Z)-cycloocta-1,5-diene);dichlororhodium?
The canonical SMILES for bis((5Z)-cycloocta-1,5-diene);dichlororhodium is C1=CCC/C=C\CC1.C1=CCC/C=C\CC1.Cl[Rh]Cl.
What is the InChIKey of bis((5Z)-cycloocta-1,5-diene);dichlororhodium?
The InChIKey is CNZJXEMAGREJBO-SXGRVCRXSA-L. The full InChI is InChI=1S/2C8H12.2ClH.Rh/c2*1-2-4-6-8-7-5-3-1;;;/h2*1-2,7-8H,3-6H2;2*1H;/q;;;;+2/p-2/b2*2-1-,8-7?;;;.
What are the key properties of bis((5Z)-cycloocta-1,5-diene);dichlororhodium?
bis((5Z)-cycloocta-1,5-diene);dichlororhodium has a molecular weight of 390.18 g/mol, XLogP of 6.72, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis((5Z)-cycloocta-1,5-diene);dichlororhodium is sourced from PubChem (CID 173413305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).