C22H18N2O5 — CID 17341336
2-[[3-[(2-methoxybenzoyl)amino]benzoyl]amino]benzoic acid (PubChem CID 17341336) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[[3-[(2-methoxybenzoyl)amino]benzoyl]amino]benzoic acid.
| Compound Name | 2-[[3-[(2-methoxybenzoyl)amino]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 17341336 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[[3-[(2-methoxybenzoyl)amino]benzoyl]amino]benzoic acid |
| SMILES | COc1ccccc1C(=O)Nc1cccc(C(=O)Nc2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C22H18N2O5/c1-29-19-12-5-3-10-17(19)21(26)23-15-8-6-7-14(13-15)20(25)24-18-11-4-2-9-16(18)22(27)28/h2-13H,1H3,(H,23,26)(H,24,25)(H,27,28) |
| InChIKey | IGRDVDJAJGBNGV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |