About CID 173413570
CID 173413570 (PubChem CID 173413570) has the molecular formula C5H12Cl3Sn2
and a molecular weight of 415.93 g/mol.
Molecular Properties
| Compound Name | CID 173413570 |
| PubChem CID | 173413570 |
| Molecular Formula | C5H12Cl3Sn2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 416.80 |
| IUPAC Name | — |
| SMILES | CCCC[Sn].C[Sn](Cl)(Cl)Cl |
| InChI | InChI=1S/C4H9.CH3.3ClH.2Sn/c1-3-4-2;;;;;;/h1,3-4H2,2H3;1H3;3*1H;;/q;;;;;;+3/p-3 |
| InChIKey | IHAVECFOEVHXMX-UHFFFAOYSA-K |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 173413570 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173413570?
The IUPAC name of CID 173413570 (CID 173413570) is not available.
What is the SMILES notation for CID 173413570?
The canonical SMILES for CID 173413570 is CCCC[Sn].C[Sn](Cl)(Cl)Cl.
What is the InChIKey of CID 173413570?
The InChIKey is IHAVECFOEVHXMX-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H9.CH3.3ClH.2Sn/c1-3-4-2;;;;;;/h1,3-4H2,2H3;1H3;3*1H;;/q;;;;;;+3/p-3.
What are the key properties of CID 173413570?
CID 173413570 has a molecular weight of 415.93 g/mol, XLogP of 3.64, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173413570 is sourced from PubChem (CID 173413570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).