About piperidin-1-amine;piperidin-1-ylcarbamic acid
piperidin-1-amine;piperidin-1-ylcarbamic acid (PubChem CID 173414027) has the molecular formula C11H24N4O2
and a molecular weight of 244.34 g/mol. Its IUPAC name is piperidin-1-amine;piperidin-1-ylcarbamic acid.
Molecular Properties
| Compound Name | piperidin-1-amine;piperidin-1-ylcarbamic acid |
| PubChem CID | 173414027 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | piperidin-1-amine;piperidin-1-ylcarbamic acid |
| SMILES | NN1CCCCC1.O=C(O)NN1CCCCC1 |
| InChI | InChI=1S/C6H12N2O2.C5H12N2/c9-6(10)7-8-4-2-1-3-5-8;6-7-4-2-1-3-5-7/h7H,1-5H2,(H,9,10);1-6H2 |
| InChIKey | QIICCGTYXCSKBI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze piperidin-1-amine;piperidin-1-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-amine;piperidin-1-ylcarbamic acid?
The IUPAC name of piperidin-1-amine;piperidin-1-ylcarbamic acid (CID 173414027) is piperidin-1-amine;piperidin-1-ylcarbamic acid.
What is the SMILES notation for piperidin-1-amine;piperidin-1-ylcarbamic acid?
The canonical SMILES for piperidin-1-amine;piperidin-1-ylcarbamic acid is NN1CCCCC1.O=C(O)NN1CCCCC1.
What is the InChIKey of piperidin-1-amine;piperidin-1-ylcarbamic acid?
The InChIKey is QIICCGTYXCSKBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.C5H12N2/c9-6(10)7-8-4-2-1-3-5-8;6-7-4-2-1-3-5-7/h7H,1-5H2,(H,9,10);1-6H2.
What are the key properties of piperidin-1-amine;piperidin-1-ylcarbamic acid?
piperidin-1-amine;piperidin-1-ylcarbamic acid has a molecular weight of 244.34 g/mol, XLogP of 1.00, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-amine;piperidin-1-ylcarbamic acid is sourced from PubChem (CID 173414027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).