C4H16N5Na — CID 173414185
sodium;butane-1,1,1,2,4-pentamine;hydride (PubChem CID 173414185) has the molecular formula C4H16N5Na and a molecular weight of 157.20 g/mol. Its IUPAC name is sodium;butane-1,1,1,2,4-pentamine;hydride.
| Compound Name | sodium;butane-1,1,1,2,4-pentamine;hydride |
|---|---|
| PubChem CID | 173414185 |
| Molecular Formula | C4H16N5Na |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | sodium;butane-1,1,1,2,4-pentamine;hydride |
| SMILES | NCCC(N)C(N)(N)N.[H-].[Na+] |
| InChI | InChI=1S/C4H15N5.Na.H/c5-2-1-3(6)4(7,8)9;;/h3H,1-2,5-9H2;;/q;+1;-1 |
| InChIKey | IXVIEDAASMBAMC-UHFFFAOYSA-N |
| XLogP | -5.69 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | -5.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|