About 1,2,3-trihexyl-1H-silole
1,2,3-trihexyl-1H-silole (PubChem CID 173414308) has the molecular formula C22H42Si
and a molecular weight of 334.66 g/mol. Its IUPAC name is 1,2,3-trihexyl-1H-silole.
Molecular Properties
| Compound Name | 1,2,3-trihexyl-1H-silole |
| PubChem CID | 173414308 |
| Molecular Formula | C22H42Si |
| Molecular Weight | 334.66 g/mol |
| Exact Mass | 334.31 |
| IUPAC Name | 1,2,3-trihexyl-1H-silole |
| SMILES | CCCCCCC1=C(CCCCCC)[SiH](CCCCCC)C=C1 |
| InChI | InChI=1S/C22H42Si/c1-4-7-10-13-16-21-18-20-23(19-15-12-9-6-3)22(21)17-14-11-8-5-2/h18,20,23H,4-17,19H2,1-3H3 |
| InChIKey | UNXWWYSJGYWQGA-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.66 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trihexyl-1H-silole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trihexyl-1H-silole?
The IUPAC name of 1,2,3-trihexyl-1H-silole (CID 173414308) is 1,2,3-trihexyl-1H-silole.
What is the SMILES notation for 1,2,3-trihexyl-1H-silole?
The canonical SMILES for 1,2,3-trihexyl-1H-silole is CCCCCCC1=C(CCCCCC)[SiH](CCCCCC)C=C1.
What is the InChIKey of 1,2,3-trihexyl-1H-silole?
The InChIKey is UNXWWYSJGYWQGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42Si/c1-4-7-10-13-16-21-18-20-23(19-15-12-9-6-3)22(21)17-14-11-8-5-2/h18,20,23H,4-17,19H2,1-3H3.
What are the key properties of 1,2,3-trihexyl-1H-silole?
1,2,3-trihexyl-1H-silole has a molecular weight of 334.66 g/mol, XLogP of 7.68, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trihexyl-1H-silole is sourced from PubChem (CID 173414308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).