About oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride
oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride (PubChem CID 173414477) has the molecular formula C10H14ClO3S2+
and a molecular weight of 281.81 g/mol. Its IUPAC name is oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride.
Molecular Properties
| Compound Name | oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride |
| PubChem CID | 173414477 |
| Molecular Formula | C10H14ClO3S2+ |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride |
| SMILES | Cc1cc(C)c(S(=O)(=O)C[S+]=O)c(C)c1.Cl |
| InChI | InChI=1S/C10H13O3S2.ClH/c1-7-4-8(2)10(9(3)5-7)15(12,13)6-14-11;/h4-5H,6H2,1-3H3;1H/q+1; |
| InChIKey | SLBQNZKSWXDHTO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride?
The IUPAC name of oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride (CID 173414477) is oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride.
What is the SMILES notation for oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride?
The canonical SMILES for oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride is Cc1cc(C)c(S(=O)(=O)C[S+]=O)c(C)c1.Cl.
What is the InChIKey of oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride?
The InChIKey is SLBQNZKSWXDHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13O3S2.ClH/c1-7-4-8(2)10(9(3)5-7)15(12,13)6-14-11;/h4-5H,6H2,1-3H3;1H/q+1;.
What are the key properties of oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride?
oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride has a molecular weight of 281.81 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-[(2,4,6-trimethylphenyl)sulfonylmethyl]sulfanium;hydrochloride is sourced from PubChem (CID 173414477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).