About sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate
sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate (PubChem CID 173414595) has the molecular formula C10H15NaO4
and a molecular weight of 222.22 g/mol. Its IUPAC name is sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate |
| PubChem CID | 173414595 |
| Molecular Formula | C10H15NaO4 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate |
| SMILES | COC(=O)C1C(=O)CC(C)(C)CC1=O.[H-].[Na+] |
| InChI | InChI=1S/C10H14O4.Na.H/c1-10(2)4-6(11)8(7(12)5-10)9(13)14-3;;/h8H,4-5H2,1-3H3;;/q;+1;-1 |
| InChIKey | HTEOZRXLJLGIRF-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate?
The IUPAC name of sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate (CID 173414595) is sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate.
What is the SMILES notation for sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate?
The canonical SMILES for sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate is COC(=O)C1C(=O)CC(C)(C)CC1=O.[H-].[Na+].
What is the InChIKey of sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate?
The InChIKey is HTEOZRXLJLGIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4.Na.H/c1-10(2)4-6(11)8(7(12)5-10)9(13)14-3;;/h8H,4-5H2,1-3H3;;/q;+1;-1.
What are the key properties of sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate?
sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate has a molecular weight of 222.22 g/mol, XLogP of -2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate is sourced from PubChem (CID 173414595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).