About 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene
5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene (PubChem CID 173415294) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene.
Molecular Properties
| Compound Name | 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene |
| PubChem CID | 173415294 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC=C1CC2C=CC1C2 |
| InChI | InChI=1S/C9H12.C4H8/c1-2-8-5-7-3-4-9(8)6-7;1-4(2)3/h2-4,7,9H,5-6H2,1H3;1H2,2-3H3 |
| InChIKey | PFOWVDYCSHJPDL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene?
The IUPAC name of 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene (CID 173415294) is 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene.
What is the SMILES notation for 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene?
The canonical SMILES for 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene is C=C(C)C.CC=C1CC2C=CC1C2.
What is the InChIKey of 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene?
The InChIKey is PFOWVDYCSHJPDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C4H8/c1-2-8-5-7-3-4-9(8)6-7;1-4(2)3/h2-4,7,9H,5-6H2,1H3;1H2,2-3H3.
What are the key properties of 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene?
5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene has a molecular weight of 176.30 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylidenebicyclo[2.2.1]hept-2-ene;2-methylprop-1-ene is sourced from PubChem (CID 173415294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).