About (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate
(1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate (PubChem CID 173415380) has the molecular formula C11H15ClO4
and a molecular weight of 246.69 g/mol. Its IUPAC name is (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate.
Molecular Properties
| Compound Name | (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate |
| PubChem CID | 173415380 |
| Molecular Formula | C11H15ClO4 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate |
| SMILES | C=CC=C(C)C(OC(C)=O)C(Cl)OC(C)=O |
| InChI | InChI=1S/C11H15ClO4/c1-5-6-7(2)10(15-8(3)13)11(12)16-9(4)14/h5-6,10-11H,1H2,2-4H3 |
| InChIKey | MUBQTZFKGBFVPT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate?
The IUPAC name of (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate (CID 173415380) is (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate.
What is the SMILES notation for (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate?
The canonical SMILES for (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate is C=CC=C(C)C(OC(C)=O)C(Cl)OC(C)=O.
What is the InChIKey of (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate?
The InChIKey is MUBQTZFKGBFVPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO4/c1-5-6-7(2)10(15-8(3)13)11(12)16-9(4)14/h5-6,10-11H,1H2,2-4H3.
What are the key properties of (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate?
(1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate has a molecular weight of 246.69 g/mol, XLogP of 2.18, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl) acetate is sourced from PubChem (CID 173415380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).