About N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol
N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol (PubChem CID 173415587) has the molecular formula C12H18ClNO2
and a molecular weight of 243.73 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol.
Molecular Properties
| Compound Name | N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol |
| PubChem CID | 173415587 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol |
| SMILES | CC(C)(C=NO)CCl.OCc1ccccc1 |
| InChI | InChI=1S/C7H8O.C5H10ClNO/c8-6-7-4-2-1-3-5-7;1-5(2,3-6)4-7-8/h1-5,8H,6H2;4,8H,3H2,1-2H3 |
| InChIKey | BMBXZPZREJDXAI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol?
The IUPAC name of N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol (CID 173415587) is N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol.
What is the SMILES notation for N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol?
The canonical SMILES for N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol is CC(C)(C=NO)CCl.OCc1ccccc1.
What is the InChIKey of N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol?
The InChIKey is BMBXZPZREJDXAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C5H10ClNO/c8-6-7-4-2-1-3-5-7;1-5(2,3-6)4-7-8/h1-5,8H,6H2;4,8H,3H2,1-2H3.
What are the key properties of N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol?
N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol has a molecular weight of 243.73 g/mol, XLogP of 2.89, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-2,2-dimethylpropylidene)hydroxylamine;phenylmethanol is sourced from PubChem (CID 173415587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).