C16H14NNaO4S — CID 173415601
sodium;5-anilino-4-hydroxynaphthalene-1-sulfonic acid;hydride (PubChem CID 173415601) has the molecular formula C16H14NNaO4S and a molecular weight of 339.35 g/mol. Its IUPAC name is sodium;5-anilino-4-hydroxynaphthalene-1-sulfonic acid;hydride.
| Compound Name | sodium;5-anilino-4-hydroxynaphthalene-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173415601 |
| Molecular Formula | C16H14NNaO4S |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | sodium;5-anilino-4-hydroxynaphthalene-1-sulfonic acid;hydride |
| SMILES | O=S(=O)(O)c1ccc(O)c2c(Nc3ccccc3)cccc12.[H-].[Na+] |
| InChI | InChI=1S/C16H13NO4S.Na.H/c18-14-9-10-15(22(19,20)21)12-7-4-8-13(16(12)14)17-11-5-2-1-3-6-11;;/h1-10,17-18H,(H,19,20,21);;/q;+1;-1 |
| InChIKey | WZRTYZIDEFGUFY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|