C17H26O — CID 173415617
2-(7-phenyloctyl)oxetane (PubChem CID 173415617) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-(7-phenyloctyl)oxetane.
| Compound Name | 2-(7-phenyloctyl)oxetane |
|---|---|
| PubChem CID | 173415617 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2-(7-phenyloctyl)oxetane |
| SMILES | CC(CCCCCCC1CCO1)c1ccccc1 |
| InChI | InChI=1S/C17H26O/c1-15(16-10-6-4-7-11-16)9-5-2-3-8-12-17-13-14-18-17/h4,6-7,10-11,15,17H,2-3,5,8-9,12-14H2,1H3 |
| InChIKey | WPMOCVYQTBCLHT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|