C25H16N2O3 — CID 173415619
4-(16-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaen-19-ylamino)-4-oxobut-2-enoic acid (PubChem CID 173415619) has the molecular formula C25H16N2O3 and a molecular weight of 392.41 g/mol. Its IUPAC name is 4-(16-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaen-19-ylamino)-4-oxobut-2-enoic acid.
| Compound Name | 4-(16-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaen-19-ylamino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 173415619 |
| Molecular Formula | C25H16N2O3 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-(16-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaen-19-ylamino)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)Nc1ccnc2c1ccc1c3cc4ccccc4cc3ccc12 |
| InChI | InChI=1S/C25H16N2O3/c28-23(9-10-24(29)30)27-22-11-12-26-25-19-6-5-17-13-15-3-1-2-4-16(15)14-21(17)18(19)7-8-20(22)25/h1-14H,(H,29,30)(H,26,27,28) |
| InChIKey | YFSLVJVXKIOPFZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|