C15H21N5O2S2 — CID 173416112
N,N-dimethyl-1-[5-[2-[(1-oxido-4-prop-2-ynylimino-1,2,5-thiadiazolidin-1-ium-3-ylidene)amino]ethylsulfanylmethyl]furan-2-yl]methanamine (PubChem CID 173416112) has the molecular formula C15H21N5O2S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is N,N-dimethyl-1-[5-[2-[(1-oxido-4-prop-2-ynylimino-1,2,5-thiadiazolidin-1-ium-3-ylidene)amino]ethylsulfanylmethyl]furan-2-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[5-[2-[(1-oxido-4-prop-2-ynylimino-1,2,5-thiadiazolidin-1-ium-3-ylidene)amino]ethylsulfanylmethyl]furan-2-yl]methanamine |
|---|---|
| PubChem CID | 173416112 |
| Molecular Formula | C15H21N5O2S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N,N-dimethyl-1-[5-[2-[(1-oxido-4-prop-2-ynylimino-1,2,5-thiadiazolidin-1-ium-3-ylidene)amino]ethylsulfanylmethyl]furan-2-yl]methanamine |
| SMILES | C#CC/N=c1\[nH][s+]([O-])[nH]\c1=N/CCSCc1ccc(CN(C)C)o1 |
| InChI | InChI=1S/C15H21N5O2S2/c1-4-7-16-14-15(19-24(21)18-14)17-8-9-23-11-13-6-5-12(22-13)10-20(2)3/h1,5-6H,7-11H2,2-3H3,(H,16,18)(H,17,19) |
| InChIKey | XWJCVERLXKOBDN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|