About sodium;hydride;1-octylphosphinane
sodium;hydride;1-octylphosphinane (PubChem CID 173416325) has the molecular formula C13H28NaP
and a molecular weight of 238.33 g/mol. Its IUPAC name is sodium;hydride;1-octylphosphinane.
Molecular Properties
| Compound Name | sodium;hydride;1-octylphosphinane |
| PubChem CID | 173416325 |
| Molecular Formula | C13H28NaP |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | sodium;hydride;1-octylphosphinane |
| SMILES | CCCCCCCCP1CCCCC1.[H-].[Na+] |
| InChI | InChI=1S/C13H27P.Na.H/c1-2-3-4-5-6-8-11-14-12-9-7-10-13-14;;/h2-13H2,1H3;;/q;+1;-1 |
| InChIKey | NCSWVXPBGCWJBB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;1-octylphosphinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;1-octylphosphinane?
The IUPAC name of sodium;hydride;1-octylphosphinane (CID 173416325) is sodium;hydride;1-octylphosphinane.
What is the SMILES notation for sodium;hydride;1-octylphosphinane?
The canonical SMILES for sodium;hydride;1-octylphosphinane is CCCCCCCCP1CCCCC1.[H-].[Na+].
What is the InChIKey of sodium;hydride;1-octylphosphinane?
The InChIKey is NCSWVXPBGCWJBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27P.Na.H/c1-2-3-4-5-6-8-11-14-12-9-7-10-13-14;;/h2-13H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;1-octylphosphinane?
sodium;hydride;1-octylphosphinane has a molecular weight of 238.33 g/mol, XLogP of 2.13, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;1-octylphosphinane is sourced from PubChem (CID 173416325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).