About 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine
1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine (PubChem CID 173416606) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine.
Molecular Properties
| Compound Name | 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine |
| PubChem CID | 173416606 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine |
| SMILES | C=CCN(C)C(C)NC1CN2CCC1CC2 |
| InChI | InChI=1S/C13H25N3/c1-4-7-15(3)11(2)14-13-10-16-8-5-12(13)6-9-16/h4,11-14H,1,5-10H2,2-3H3 |
| InChIKey | URRWFFOLZKMIBF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine?
The IUPAC name of 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine (CID 173416606) is 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine.
What is the SMILES notation for 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine?
The canonical SMILES for 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine is C=CCN(C)C(C)NC1CN2CCC1CC2.
What is the InChIKey of 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine?
The InChIKey is URRWFFOLZKMIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3/c1-4-7-15(3)11(2)14-13-10-16-8-5-12(13)6-9-16/h4,11-14H,1,5-10H2,2-3H3.
What are the key properties of 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine?
1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine has a molecular weight of 223.36 g/mol, XLogP of 1.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(1-azabicyclo[2.2.2]octan-3-yl)-1-N'-methyl-1-N'-prop-2-enylethane-1,1-diamine is sourced from PubChem (CID 173416606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).