C32H54N2O5S — CID 173417438
(1R,4aS,10aR)-4a-methyl-7-propan-2-yl-1-(sulfomethyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid;bis(cyclohexanamine) (PubChem CID 173417438) has the molecular formula C32H54N2O5S and a molecular weight of 578.86 g/mol. Its IUPAC name is (1R,4aS,10aR)-4a-methyl-7-propan-2-yl-1-(sulfomethyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid;bis(cyclohexanamine).
| Compound Name | (1R,4aS,10aR)-4a-methyl-7-propan-2-yl-1-(sulfomethyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid;bis(cyclohexanamine) |
|---|---|
| PubChem CID | 173417438 |
| Molecular Formula | C32H54N2O5S |
| Molecular Weight | 578.86 g/mol |
| Exact Mass | 578.38 |
| IUPAC Name | (1R,4aS,10aR)-4a-methyl-7-propan-2-yl-1-(sulfomethyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid;bis(cyclohexanamine) |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@@](CS(=O)(=O)O)(C(=O)O)CCC[C@]21C.NC1CCCCC1.NC1CCCCC1 |
| InChI | InChI=1S/C20H28O5S.2C6H13N/c1-13(2)14-5-7-16-15(11-14)6-8-17-19(16,3)9-4-10-20(17,18(21)22)12-26(23,24)25;2*7-6-4-2-1-3-5-6/h5,7,11,13,17H,4,6,8-10,12H2,1-3H3,(H,21,22)(H,23,24,25);2*6H,1-5,7H2/t17-,19-,20-;;/m1../s1 |
| InChIKey | JKNFOXQVSSZSTJ-MUMAJMNHSA-N |
| XLogP | 6.33 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.86 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|