About zinc;4-aminobenzenediazonium;trichloride
zinc;4-aminobenzenediazonium;trichloride (PubChem CID 173419318) has the molecular formula C6H6Cl3N3Zn
and a molecular weight of 291.88 g/mol. Its IUPAC name is zinc;4-aminobenzenediazonium;trichloride.
Molecular Properties
| Compound Name | zinc;4-aminobenzenediazonium;trichloride |
| PubChem CID | 173419318 |
| Molecular Formula | C6H6Cl3N3Zn |
| Molecular Weight | 291.88 g/mol |
| Exact Mass | 288.89 |
| IUPAC Name | zinc;4-aminobenzenediazonium;trichloride |
| SMILES | N#[N+]c1ccc(N)cc1.[Cl-].[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C6H6N3.3ClH.Zn/c7-5-1-3-6(9-8)4-2-5;;;;/h1-4H,7H2;3*1H;/q+1;;;;+2/p-3 |
| InChIKey | POHLYFKJJZAOFB-UHFFFAOYSA-K |
| XLogP | -7.24 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.88 |
| LogP ≤ 5 | -7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;4-aminobenzenediazonium;trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;4-aminobenzenediazonium;trichloride?
The IUPAC name of zinc;4-aminobenzenediazonium;trichloride (CID 173419318) is zinc;4-aminobenzenediazonium;trichloride.
What is the SMILES notation for zinc;4-aminobenzenediazonium;trichloride?
The canonical SMILES for zinc;4-aminobenzenediazonium;trichloride is N#[N+]c1ccc(N)cc1.[Cl-].[Cl-].[Cl-].[Zn+2].
What is the InChIKey of zinc;4-aminobenzenediazonium;trichloride?
The InChIKey is POHLYFKJJZAOFB-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H6N3.3ClH.Zn/c7-5-1-3-6(9-8)4-2-5;;;;/h1-4H,7H2;3*1H;/q+1;;;;+2/p-3.
What are the key properties of zinc;4-aminobenzenediazonium;trichloride?
zinc;4-aminobenzenediazonium;trichloride has a molecular weight of 291.88 g/mol, XLogP of -7.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;4-aminobenzenediazonium;trichloride is sourced from PubChem (CID 173419318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).