C6H21N5O6P2S2 — CID 173419385
methane;6-methyl-1,3,5-triazine-2,4-diamine;bis(trihydroxy(sulfanylidene)-λ5-phosphane) (PubChem CID 173419385) has the molecular formula C6H21N5O6P2S2 and a molecular weight of 385.35 g/mol. Its IUPAC name is methane;6-methyl-1,3,5-triazine-2,4-diamine;bis(trihydroxy(sulfanylidene)-λ5-phosphane).
| Compound Name | methane;6-methyl-1,3,5-triazine-2,4-diamine;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
|---|---|
| PubChem CID | 173419385 |
| Molecular Formula | C6H21N5O6P2S2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | methane;6-methyl-1,3,5-triazine-2,4-diamine;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
| SMILES | C.C.Cc1nc(N)nc(N)n1.OP(O)(O)=S.OP(O)(O)=S |
| InChI | InChI=1S/C4H7N5.2CH4.2H3O3PS/c1-2-7-3(5)9-4(6)8-2;;;2*1-4(2,3)5/h1H3,(H4,5,6,7,8,9);2*1H4;2*(H3,1,2,3,5) |
| InChIKey | MEEFYOJLKAYRKK-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 212.09 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|