About (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane
(3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane (PubChem CID 173419809) has the molecular formula C12H22O3Si
and a molecular weight of 242.39 g/mol. Its IUPAC name is (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane.
Molecular Properties
| Compound Name | (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane |
| PubChem CID | 173419809 |
| Molecular Formula | C12H22O3Si |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane |
| SMILES | C=CC1(OCC)CCCC(O[SiH3])=C1OCC |
| InChI | InChI=1S/C12H22O3Si/c1-4-12(14-6-3)9-7-8-10(15-16)11(12)13-5-2/h4H,1,5-9H2,2-3,16H3 |
| InChIKey | MRHXPLVKQZTICQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane?
The IUPAC name of (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane (CID 173419809) is (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane.
What is the SMILES notation for (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane?
The canonical SMILES for (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane is C=CC1(OCC)CCCC(O[SiH3])=C1OCC.
What is the InChIKey of (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane?
The InChIKey is MRHXPLVKQZTICQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3Si/c1-4-12(14-6-3)9-7-8-10(15-16)11(12)13-5-2/h4H,1,5-9H2,2-3,16H3.
What are the key properties of (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane?
(3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane has a molecular weight of 242.39 g/mol, XLogP of 1.68, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethenyl-2,3-diethoxycyclohexen-1-yl)oxysilane is sourced from PubChem (CID 173419809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).