C35H66 — CID 173419999
(1Z,4Z,6S,8R)-1,2,3,3,4,5,6,7,8-nonapropylcycloocta-1,4-diene (PubChem CID 173419999) has the molecular formula C35H66 and a molecular weight of 486.91 g/mol. Its IUPAC name is (1Z,4Z,6S,8R)-1,2,3,3,4,5,6,7,8-nonapropylcycloocta-1,4-diene.
| Compound Name | (1Z,4Z,6S,8R)-1,2,3,3,4,5,6,7,8-nonapropylcycloocta-1,4-diene |
|---|---|
| PubChem CID | 173419999 |
| Molecular Formula | C35H66 |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.52 |
| IUPAC Name | (1Z,4Z,6S,8R)-1,2,3,3,4,5,6,7,8-nonapropylcycloocta-1,4-diene |
| SMILES | CCC/C1=C(\CCC)C(CCC)(CCC)/C(CCC)=C(/CCC)[C@H](CCC)C(CCC)[C@@H]1CCC |
| InChI | InChI=1S/C35H66/c1-10-19-28-29(20-11-2)31(22-13-4)33(24-15-6)35(26-17-8,27-18-9)34(25-16-7)32(23-14-5)30(28)21-12-3/h28-30H,10-27H2,1-9H3/b33-31-,34-32-/t28?,29-,30+ |
| InChIKey | BLLNJEUEYFJLJJ-YFWUJASLSA-N |
| XLogP | 12.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|