About azane;[(E)-but-1-enyl] octadecanoate;ethene
azane;[(E)-but-1-enyl] octadecanoate;ethene (PubChem CID 173420288) has the molecular formula C24H52N2O2
and a molecular weight of 400.69 g/mol. Its IUPAC name is azane;[(E)-but-1-enyl] octadecanoate;ethene.
Molecular Properties
| Compound Name | azane;[(E)-but-1-enyl] octadecanoate;ethene |
| PubChem CID | 173420288 |
| Molecular Formula | C24H52N2O2 |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.40 |
| IUPAC Name | azane;[(E)-but-1-enyl] octadecanoate;ethene |
| SMILES | C=C.CC/C=C/OC(=O)CCCCCCCCCCCCCCCCC.N.N |
| InChI | InChI=1S/C22H42O2.C2H4.2H3N/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(23)24-21-6-4-2;1-2;;/h6,21H,3-5,7-20H2,1-2H3;1-2H2;2*1H3/b21-6+;;; |
| InChIKey | CRPOSOSZCQBVRP-OEHBVTDJSA-N |
| XLogP | 8.84 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;[(E)-but-1-enyl] octadecanoate;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;[(E)-but-1-enyl] octadecanoate;ethene?
The IUPAC name of azane;[(E)-but-1-enyl] octadecanoate;ethene (CID 173420288) is azane;[(E)-but-1-enyl] octadecanoate;ethene.
What is the SMILES notation for azane;[(E)-but-1-enyl] octadecanoate;ethene?
The canonical SMILES for azane;[(E)-but-1-enyl] octadecanoate;ethene is C=C.CC/C=C/OC(=O)CCCCCCCCCCCCCCCCC.N.N.
What is the InChIKey of azane;[(E)-but-1-enyl] octadecanoate;ethene?
The InChIKey is CRPOSOSZCQBVRP-OEHBVTDJSA-N. The full InChI is InChI=1S/C22H42O2.C2H4.2H3N/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(23)24-21-6-4-2;1-2;;/h6,21H,3-5,7-20H2,1-2H3;1-2H2;2*1H3/b21-6+;;;.
What are the key properties of azane;[(E)-but-1-enyl] octadecanoate;ethene?
azane;[(E)-but-1-enyl] octadecanoate;ethene has a molecular weight of 400.69 g/mol, XLogP of 8.84, 18 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;[(E)-but-1-enyl] octadecanoate;ethene is sourced from PubChem (CID 173420288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).