About (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal
(2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal (PubChem CID 173420855) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal.
Molecular Properties
| Compound Name | (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal |
| PubChem CID | 173420855 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal |
| SMILES | CC(C)C[C@H](N)C[C@@](N)(C=O)CO |
| InChI | InChI=1S/C9H20N2O2/c1-7(2)3-8(10)4-9(11,5-12)6-13/h5,7-8,13H,3-4,6,10-11H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | SDPMMSKIFALBMK-DTWKUNHWSA-N |
| XLogP | -0.36 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal?
The IUPAC name of (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal (CID 173420855) is (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal.
What is the SMILES notation for (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal?
The canonical SMILES for (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal is CC(C)C[C@H](N)C[C@@](N)(C=O)CO.
What is the InChIKey of (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal?
The InChIKey is SDPMMSKIFALBMK-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-7(2)3-8(10)4-9(11,5-12)6-13/h5,7-8,13H,3-4,6,10-11H2,1-2H3/t8-,9+/m0/s1.
What are the key properties of (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal?
(2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal has a molecular weight of 188.27 g/mol, XLogP of -0.36, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-2,4-diamino-2-(hydroxymethyl)-6-methylheptanal is sourced from PubChem (CID 173420855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).