C20H24INO2 — CID 173421024
3,17-dimethoxy-5-methyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,9,11,14(18)-hexaene;hydroiodide (PubChem CID 173421024) has the molecular formula C20H24INO2 and a molecular weight of 437.32 g/mol. Its IUPAC name is 3,17-dimethoxy-5-methyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,9,11,14(18)-hexaene;hydroiodide.
| Compound Name | 3,17-dimethoxy-5-methyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,9,11,14(18)-hexaene;hydroiodide |
|---|---|
| PubChem CID | 173421024 |
| Molecular Formula | C20H24INO2 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 3,17-dimethoxy-5-methyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,9,11,14(18)-hexaene;hydroiodide |
| SMILES | COC1=CC(C)CC2=C1C1=C(OC)NCC3=C1C(=CC2)C=CC3.I |
| InChI | InChI=1S/C20H23NO2.HI/c1-12-9-14-8-7-13-5-4-6-15-11-21-20(23-3)19(17(13)15)18(14)16(10-12)22-2;/h4-5,7,10,12,21H,6,8-9,11H2,1-3H3;1H |
| InChIKey | MQGXLQPOVMTXSC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|