About 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione
6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione (PubChem CID 173421072) has the molecular formula C8H10O2S
and a molecular weight of 170.23 g/mol. Its IUPAC name is 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione.
Molecular Properties
| Compound Name | 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione |
| PubChem CID | 173421072 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione |
| SMILES | COC1=C(C)C=CC(=S)C1O |
| InChI | InChI=1S/C8H10O2S/c1-5-3-4-6(11)7(9)8(5)10-2/h3-4,7,9H,1-2H3 |
| InChIKey | IOQWDNHDYMVCCE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione?
The IUPAC name of 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione (CID 173421072) is 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione.
What is the SMILES notation for 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione?
The canonical SMILES for 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione is COC1=C(C)C=CC(=S)C1O.
What is the InChIKey of 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione?
The InChIKey is IOQWDNHDYMVCCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S/c1-5-3-4-6(11)7(9)8(5)10-2/h3-4,7,9H,1-2H3.
What are the key properties of 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione?
6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione has a molecular weight of 170.23 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-5-methoxy-4-methylcyclohexa-2,4-diene-1-thione is sourced from PubChem (CID 173421072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).