About sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol
sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol (PubChem CID 173421371) has the molecular formula C12H11NaO3S
and a molecular weight of 258.27 g/mol. Its IUPAC name is sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol.
Molecular Properties
| Compound Name | sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol |
| PubChem CID | 173421371 |
| Molecular Formula | C12H11NaO3S |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol |
| SMILES | O=S(c1ccc(O)cc1)c1ccc(O)cc1.[H-].[Na+] |
| InChI | InChI=1S/C12H10O3S.Na.H/c13-9-1-5-11(6-2-9)16(15)12-7-3-10(14)4-8-12;;/h1-8,13-14H;;/q;+1;-1 |
| InChIKey | FTOUHLMEHIIXCA-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol?
The IUPAC name of sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol (CID 173421371) is sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol.
What is the SMILES notation for sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol?
The canonical SMILES for sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol is O=S(c1ccc(O)cc1)c1ccc(O)cc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol?
The InChIKey is FTOUHLMEHIIXCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O3S.Na.H/c13-9-1-5-11(6-2-9)16(15)12-7-3-10(14)4-8-12;;/h1-8,13-14H;;/q;+1;-1.
What are the key properties of sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol?
sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol has a molecular weight of 258.27 g/mol, XLogP of -0.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-(4-hydroxyphenyl)sulfinylphenol is sourced from PubChem (CID 173421371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).