About 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene
2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene (PubChem CID 173423104) has the molecular formula C16H30O
and a molecular weight of 238.41 g/mol. Its IUPAC name is 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene.
Molecular Properties
| Compound Name | 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene |
| PubChem CID | 173423104 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene |
| SMILES | CC(=CCC(C)(C)C)OC(C)=CCC(C)(C)C |
| InChI | InChI=1S/C16H30O/c1-13(9-11-15(3,4)5)17-14(2)10-12-16(6,7)8/h9-10H,11-12H2,1-8H3 |
| InChIKey | DBNZAGQWMPFOBS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene?
The IUPAC name of 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene (CID 173423104) is 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene.
What is the SMILES notation for 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene?
The canonical SMILES for 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene is CC(=CCC(C)(C)C)OC(C)=CCC(C)(C)C.
What is the InChIKey of 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene?
The InChIKey is DBNZAGQWMPFOBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O/c1-13(9-11-15(3,4)5)17-14(2)10-12-16(6,7)8/h9-10H,11-12H2,1-8H3.
What are the key properties of 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene?
2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene has a molecular weight of 238.41 g/mol, XLogP of 5.68, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dimethylhex-2-en-2-yloxy)-5,5-dimethylhex-2-ene is sourced from PubChem (CID 173423104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).