About (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene
(15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene (PubChem CID 173424185) has the molecular formula C22H35N
and a molecular weight of 313.53 g/mol. Its IUPAC name is (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene.
Molecular Properties
| Compound Name | (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene |
| PubChem CID | 173424185 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene |
| SMILES | C1=CCC(C2CCCCC2)/N=C/C2(C/C=C/CC1)CCCCC2 |
| InChI | InChI=1S/C22H35N/c1-2-4-10-16-22(17-11-6-12-18-22)19-23-21(15-9-3-1)20-13-7-5-8-14-20/h3-4,9-10,19-21H,1-2,5-8,11-18H2/b9-3?,10-4+,23-19+ |
| InChIKey | ACSPPLDUFWCSAK-DUAIBYMGSA-N |
| XLogP | 6.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene?
The IUPAC name of (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene (CID 173424185) is (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene.
What is the SMILES notation for (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene?
The canonical SMILES for (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene is C1=CCC(C2CCCCC2)/N=C/C2(C/C=C/CC1)CCCCC2.
What is the InChIKey of (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene?
The InChIKey is ACSPPLDUFWCSAK-DUAIBYMGSA-N. The full InChI is InChI=1S/C22H35N/c1-2-4-10-16-22(17-11-6-12-18-22)19-23-21(15-9-3-1)20-13-7-5-8-14-20/h3-4,9-10,19-21H,1-2,5-8,11-18H2/b9-3?,10-4+,23-19+.
What are the key properties of (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene?
(15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene has a molecular weight of 313.53 g/mol, XLogP of 6.64, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (15E)-9-cyclohexyl-8-azaspiro[5.11]heptadeca-7,11,15-triene is sourced from PubChem (CID 173424185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).