About magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride
magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride (PubChem CID 173424213) has the molecular formula C11H15ClMg
and a molecular weight of 207.00 g/mol. Its IUPAC name is magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride.
Molecular Properties
| Compound Name | magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride |
| PubChem CID | 173424213 |
| Molecular Formula | C11H15ClMg |
| Molecular Weight | 207.00 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride |
| SMILES | CC(C)=CCc1ccc(Cl)cc1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C11H13Cl.Mg.2H/c1-9(2)3-4-10-5-7-11(12)8-6-10;;;/h3,5-8H,4H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | UVZDMAWRZLMRTD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.00 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride?
The IUPAC name of magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride (CID 173424213) is magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride.
What is the SMILES notation for magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride?
The canonical SMILES for magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride is CC(C)=CCc1ccc(Cl)cc1.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride?
The InChIKey is UVZDMAWRZLMRTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl.Mg.2H/c1-9(2)3-4-10-5-7-11(12)8-6-10;;;/h3,5-8H,4H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride?
magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride has a molecular weight of 207.00 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1-chloro-4-(3-methylbut-2-enyl)benzene;hydride is sourced from PubChem (CID 173424213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).