About azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one
azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one (PubChem CID 173424279) has the molecular formula C15H30N2O3Si
and a molecular weight of 314.50 g/mol. Its IUPAC name is azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one.
Molecular Properties
| Compound Name | azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one |
| PubChem CID | 173424279 |
| Molecular Formula | C15H30N2O3Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one |
| SMILES | CC(C)OC1([SiH3])CCCCNC1=O.O=C1CCCCCN1 |
| InChI | InChI=1S/C9H19NO2Si.C6H11NO/c1-7(2)12-9(13)5-3-4-6-10-8(9)11;8-6-4-2-1-3-5-7-6/h7H,3-6H2,1-2,13H3,(H,10,11);1-5H2,(H,7,8) |
| InChIKey | WWKBYVGFYPATCD-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one?
The IUPAC name of azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one (CID 173424279) is azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one.
What is the SMILES notation for azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one?
The canonical SMILES for azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one is CC(C)OC1([SiH3])CCCCNC1=O.O=C1CCCCCN1.
What is the InChIKey of azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one?
The InChIKey is WWKBYVGFYPATCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2Si.C6H11NO/c1-7(2)12-9(13)5-3-4-6-10-8(9)11;8-6-4-2-1-3-5-7-6/h7H,3-6H2,1-2,13H3,(H,10,11);1-5H2,(H,7,8).
What are the key properties of azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one?
azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one has a molecular weight of 314.50 g/mol, XLogP of 0.45, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-2-one;3-propan-2-yloxy-3-silylazepan-2-one is sourced from PubChem (CID 173424279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).