About alumane;butane;ethoxy(phenyl)silane
alumane;butane;ethoxy(phenyl)silane (PubChem CID 173424285) has the molecular formula C12H25AlOSi
and a molecular weight of 240.40 g/mol. Its IUPAC name is alumane;butane;ethoxy(phenyl)silane.
Molecular Properties
| Compound Name | alumane;butane;ethoxy(phenyl)silane |
| PubChem CID | 173424285 |
| Molecular Formula | C12H25AlOSi |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | alumane;butane;ethoxy(phenyl)silane |
| SMILES | CCCC.CCO[SiH2]c1ccccc1.[AlH3] |
| InChI | InChI=1S/C8H12OSi.C4H10.Al.3H/c1-2-9-10-8-6-4-3-5-7-8;1-3-4-2;;;;/h3-7H,2,10H2,1H3;3-4H2,1-2H3;;;; |
| InChIKey | WWKIZLMHQIOTNE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze alumane;butane;ethoxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;butane;ethoxy(phenyl)silane?
The IUPAC name of alumane;butane;ethoxy(phenyl)silane (CID 173424285) is alumane;butane;ethoxy(phenyl)silane.
What is the SMILES notation for alumane;butane;ethoxy(phenyl)silane?
The canonical SMILES for alumane;butane;ethoxy(phenyl)silane is CCCC.CCO[SiH2]c1ccccc1.[AlH3].
What is the InChIKey of alumane;butane;ethoxy(phenyl)silane?
The InChIKey is WWKIZLMHQIOTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OSi.C4H10.Al.3H/c1-2-9-10-8-6-4-3-5-7-8;1-3-4-2;;;;/h3-7H,2,10H2,1H3;3-4H2,1-2H3;;;;.
What are the key properties of alumane;butane;ethoxy(phenyl)silane?
alumane;butane;ethoxy(phenyl)silane has a molecular weight of 240.40 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;butane;ethoxy(phenyl)silane is sourced from PubChem (CID 173424285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).