C18H23N3O8S — CID 173424836
2,2-dimethylpropanoyloxymethyl (6R,7S)-7-(1-acetyloxyethyl)-4-diazo-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 173424836) has the molecular formula C18H23N3O8S and a molecular weight of 441.46 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (6R,7S)-7-(1-acetyloxyethyl)-4-diazo-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (6R,7S)-7-(1-acetyloxyethyl)-4-diazo-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 173424836 |
| Molecular Formula | C18H23N3O8S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (6R,7S)-7-(1-acetyloxyethyl)-4-diazo-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OC(C)[C@H]1C(=O)N2C(C(=O)OCOC(=O)C(C)(C)C)=C(C)C(=[N+]=[N-])S(=O)[C@H]12 |
| InChI | InChI=1S/C18H23N3O8S/c1-8-12(16(24)27-7-28-17(25)18(4,5)6)21-14(23)11(9(2)29-10(3)22)15(21)30(26)13(8)20-19/h9,11,15H,7H2,1-6H3/t9?,11-,15+,30?/m0/s1 |
| InChIKey | CECFCKGZGNELET-DEAZAXQFSA-N |
| XLogP | 0.48 |
| TPSA | 152.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|