About (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride
(1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride (PubChem CID 173424902) has the molecular formula C13H20ClNOS
and a molecular weight of 273.83 g/mol. Its IUPAC name is (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride.
Molecular Properties
| Compound Name | (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride |
| PubChem CID | 173424902 |
| Molecular Formula | C13H20ClNOS |
| Molecular Weight | 273.83 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride |
| SMILES | CC[C@@]1(c2ccccc2)CN(C)CC[S@@]1=O.Cl |
| InChI | InChI=1S/C13H19NOS.ClH/c1-3-13(12-7-5-4-6-8-12)11-14(2)9-10-16(13)15;/h4-8H,3,9-11H2,1-2H3;1H/t13-,16-;/m0./s1 |
| InChIKey | UZWHZPNFWXUJBE-LINSIKMZSA-N |
| XLogP | 2.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.83 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride?
The IUPAC name of (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride (CID 173424902) is (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride.
What is the SMILES notation for (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride?
The canonical SMILES for (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride is CC[C@@]1(c2ccccc2)CN(C)CC[S@@]1=O.Cl.
What is the InChIKey of (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride?
The InChIKey is UZWHZPNFWXUJBE-LINSIKMZSA-N. The full InChI is InChI=1S/C13H19NOS.ClH/c1-3-13(12-7-5-4-6-8-12)11-14(2)9-10-16(13)15;/h4-8H,3,9-11H2,1-2H3;1H/t13-,16-;/m0./s1.
What are the key properties of (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride?
(1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride has a molecular weight of 273.83 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-2-ethyl-4-methyl-2-phenyl-1,4-thiazinane 1-oxide;hydrochloride is sourced from PubChem (CID 173424902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).