C10H15N5O3S — CID 173425118
but-2-ene;1-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-sulfonylurea (PubChem CID 173425118) has the molecular formula C10H15N5O3S and a molecular weight of 285.33 g/mol. Its IUPAC name is but-2-ene;1-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-sulfonylurea.
| Compound Name | but-2-ene;1-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-sulfonylurea |
|---|---|
| PubChem CID | 173425118 |
| Molecular Formula | C10H15N5O3S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | but-2-ene;1-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-sulfonylurea |
| SMILES | CC=CC.Cc1nc(C)nc(NC(=O)N=S(=O)=O)n1 |
| InChI | InChI=1S/C6H7N5O3S.C4H8/c1-3-7-4(2)9-5(8-3)10-6(12)11-15(13)14;1-3-4-2/h1-2H3,(H,7,8,9,10,12);3-4H,1-2H3 |
| InChIKey | SDMUMEXUQYBBEO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|