About disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride
disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride (PubChem CID 173425288) has the molecular formula C10H17NNa2O6
and a molecular weight of 293.23 g/mol. Its IUPAC name is disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride.
Molecular Properties
| Compound Name | disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride |
| PubChem CID | 173425288 |
| Molecular Formula | C10H17NNa2O6 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride |
| SMILES | CCOC(=O)/C=C(\C)N[C@@H](CC(=O)O)C(=O)O.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C10H15NO6.2Na.2H/c1-3-17-9(14)4-6(2)11-7(10(15)16)5-8(12)13;;;;/h4,7,11H,3,5H2,1-2H3,(H,12,13)(H,15,16);;;;/q;2*+1;2*-1/b6-4+;;;;/t7-;;;;/m0..../s1 |
| InChIKey | KMBRCXRIFVSURP-OBMOWVSDSA-N |
| XLogP | -5.80 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | -5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride?
The IUPAC name of disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride (CID 173425288) is disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride.
What is the SMILES notation for disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride?
The canonical SMILES for disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride is CCOC(=O)/C=C(\C)N[C@@H](CC(=O)O)C(=O)O.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride?
The InChIKey is KMBRCXRIFVSURP-OBMOWVSDSA-N. The full InChI is InChI=1S/C10H15NO6.2Na.2H/c1-3-17-9(14)4-6(2)11-7(10(15)16)5-8(12)13;;;;/h4,7,11H,3,5H2,1-2H3,(H,12,13)(H,15,16);;;;/q;2*+1;2*-1/b6-4+;;;;/t7-;;;;/m0..../s1.
What are the key properties of disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride?
disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride has a molecular weight of 293.23 g/mol, XLogP of -5.80, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]butanedioic acid;hydride is sourced from PubChem (CID 173425288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).