About sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride
sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride (PubChem CID 173426892) has the molecular formula C16H11BrCl2F3NaO2
and a molecular weight of 466.06 g/mol. Its IUPAC name is sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride.
Molecular Properties
| Compound Name | sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride |
| PubChem CID | 173426892 |
| Molecular Formula | C16H11BrCl2F3NaO2 |
| Molecular Weight | 466.06 g/mol |
| Exact Mass | 463.92 |
| IUPAC Name | sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride |
| SMILES | CCC(=O)c1cc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1Br.[H-].[Na+] |
| InChI | InChI=1S/C16H10BrCl2F3O2.Na.H/c1-2-14(23)10-7-9(3-4-11(10)17)24-15-12(18)5-8(6-13(15)19)16(20,21)22;;/h3-7H,2H2,1H3;;/q;+1;-1 |
| InChIKey | OVGWBVVPQOCZAR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.06 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride?
The IUPAC name of sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride (CID 173426892) is sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride.
What is the SMILES notation for sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride?
The canonical SMILES for sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride is CCC(=O)c1cc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1Br.[H-].[Na+].
What is the InChIKey of sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride?
The InChIKey is OVGWBVVPQOCZAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BrCl2F3O2.Na.H/c1-2-14(23)10-7-9(3-4-11(10)17)24-15-12(18)5-8(6-13(15)19)16(20,21)22;;/h3-7H,2H2,1H3;;/q;+1;-1.
What are the key properties of sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride?
sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride has a molecular weight of 466.06 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-[2-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenyl]propan-1-one;hydride is sourced from PubChem (CID 173426892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).