About anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride
anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride (PubChem CID 173428385) has the molecular formula C16H24Cl2N2O2
and a molecular weight of 347.29 g/mol. Its IUPAC name is anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride.
Molecular Properties
| Compound Name | anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride |
| PubChem CID | 173428385 |
| Molecular Formula | C16H24Cl2N2O2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride |
| SMILES | COc1c(N)cc(C)c(N)c1C.COc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C9H14N2O.C7H8O.2ClH/c1-5-4-7(10)9(12-3)6(2)8(5)11;1-8-7-5-3-2-4-6-7;;/h4H,10-11H2,1-3H3;2-6H,1H3;2*1H |
| InChIKey | CFCNHHFPAUHBEK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride?
The IUPAC name of anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride (CID 173428385) is anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride.
What is the SMILES notation for anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride?
The canonical SMILES for anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride is COc1c(N)cc(C)c(N)c1C.COc1ccccc1.Cl.Cl.
What is the InChIKey of anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride?
The InChIKey is CFCNHHFPAUHBEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O.C7H8O.2ClH/c1-5-4-7(10)9(12-3)6(2)8(5)11;1-8-7-5-3-2-4-6-7;;/h4H,10-11H2,1-3H3;2-6H,1H3;2*1H.
What are the key properties of anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride?
anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride has a molecular weight of 347.29 g/mol, XLogP of 4.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride is sourced from PubChem (CID 173428385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).