C13H24F3N3O3PS+ — CID 173428463
[bis(butylamino)-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]methyl]-sulfanylidenephosphanium (PubChem CID 173428463) has the molecular formula C13H24F3N3O3PS+ and a molecular weight of 390.39 g/mol. Its IUPAC name is [bis(butylamino)-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]methyl]-sulfanylidenephosphanium.
| Compound Name | [bis(butylamino)-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]methyl]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 173428463 |
| Molecular Formula | C13H24F3N3O3PS+ |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [bis(butylamino)-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]methyl]-sulfanylidenephosphanium |
| SMILES | CCCCNC(NCCCC)([PH+]=S)N(CC(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H23F3N3O3PS/c1-3-5-7-17-13(23-24,18-8-6-4-2)19(9-10(20)21)11(22)12(14,15)16/h17-18H,3-9H2,1-2H3,(H,20,21)/p+1 |
| InChIKey | MDLXRLCIHFSZCS-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|