C17H32F3N3O3PS+ — CID 173428472
[[carboxymethyl-(2,2,2-trifluoroacetyl)amino]-bis(dipropylamino)methyl]-sulfanylidenephosphanium (PubChem CID 173428472) has the molecular formula C17H32F3N3O3PS+ and a molecular weight of 446.50 g/mol. Its IUPAC name is [[carboxymethyl-(2,2,2-trifluoroacetyl)amino]-bis(dipropylamino)methyl]-sulfanylidenephosphanium.
| Compound Name | [[carboxymethyl-(2,2,2-trifluoroacetyl)amino]-bis(dipropylamino)methyl]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 173428472 |
| Molecular Formula | C17H32F3N3O3PS+ |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [[carboxymethyl-(2,2,2-trifluoroacetyl)amino]-bis(dipropylamino)methyl]-sulfanylidenephosphanium |
| SMILES | CCCN(CCC)C([PH+]=S)(N(CCC)CCC)N(CC(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C17H31F3N3O3PS/c1-5-9-21(10-6-2)17(27-28,22(11-7-3)12-8-4)23(13-14(24)25)15(26)16(18,19)20/h5-13H2,1-4H3,(H,24,25)/p+1 |
| InChIKey | DJPQRUZSQYLVGU-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|