C10H18F3N3O3PS+ — CID 173428498
[[carboxymethyl(3,3,3-trifluoropropanoyl)amino]-bis(dimethylamino)methyl]-sulfanylidenephosphanium (PubChem CID 173428498) has the molecular formula C10H18F3N3O3PS+ and a molecular weight of 348.31 g/mol. Its IUPAC name is [[carboxymethyl(3,3,3-trifluoropropanoyl)amino]-bis(dimethylamino)methyl]-sulfanylidenephosphanium.
| Compound Name | [[carboxymethyl(3,3,3-trifluoropropanoyl)amino]-bis(dimethylamino)methyl]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 173428498 |
| Molecular Formula | C10H18F3N3O3PS+ |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [[carboxymethyl(3,3,3-trifluoropropanoyl)amino]-bis(dimethylamino)methyl]-sulfanylidenephosphanium |
| SMILES | CN(C)C([PH+]=S)(N(C)C)N(CC(=O)O)C(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H17F3N3O3PS/c1-14(2)10(20-21,15(3)4)16(6-8(18)19)7(17)5-9(11,12)13/h5-6H2,1-4H3,(H,18,19)/p+1 |
| InChIKey | NTTXSAICSSSPLV-UHFFFAOYSA-O |
| XLogP | 0.73 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|